C10H9NO6S — CID 43446375
6-ethenylsulfonyl-7-nitro-2,3-dihydro-1,4-benzodioxine (PubChem CID 43446375) has the molecular formula C10H9NO6S and a molecular weight of 271.25 g/mol. Its IUPAC name is 6-ethenylsulfonyl-7-nitro-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-ethenylsulfonyl-7-nitro-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 43446375 |
| Molecular Formula | C10H9NO6S |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 6-ethenylsulfonyl-7-nitro-2,3-dihydro-1,4-benzodioxine |
| SMILES | C=CS(=O)(=O)c1cc2c(cc1[N+](=O)[O-])OCCO2 |
| InChI | InChI=1S/C10H9NO6S/c1-2-18(14,15)10-6-9-8(16-3-4-17-9)5-7(10)11(12)13/h2,5-6H,1,3-4H2 |
| InChIKey | HCQCWJXAVQPBAS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|