C12H16ClN3O6S — CID 119962543
(3R)-1-[(7-nitro-2,3-dihydro-1,4-benzodioxin-6-yl)sulfonyl]pyrrolidin-3-amine;hydrochloride (PubChem CID 119962543) has the molecular formula C12H16ClN3O6S and a molecular weight of 365.80 g/mol. Its IUPAC name is (3R)-1-[(7-nitro-2,3-dihydro-1,4-benzodioxin-6-yl)sulfonyl]pyrrolidin-3-amine;hydrochloride.
| Compound Name | (3R)-1-[(7-nitro-2,3-dihydro-1,4-benzodioxin-6-yl)sulfonyl]pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119962543 |
| Molecular Formula | C12H16ClN3O6S |
| Molecular Weight | 365.80 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | (3R)-1-[(7-nitro-2,3-dihydro-1,4-benzodioxin-6-yl)sulfonyl]pyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.N[C@@H]1CCN(S(=O)(=O)c2cc3c(cc2[N+](=O)[O-])OCCO3)C1 |
| InChI | InChI=1S/C12H15N3O6S.ClH/c13-8-1-2-14(7-8)22(18,19)12-6-11-10(20-3-4-21-11)5-9(12)15(16)17;/h5-6,8H,1-4,7,13H2;1H/t8-;/m1./s1 |
| InChIKey | KTZQVDMXZJZXDZ-DDWIOCJRSA-N |
| XLogP | 0.51 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.80 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|