C10H13Cl2N3O4S — CID 119971647
1-(2-chloro-4-nitrophenyl)sulfonylpyrrolidin-3-amine;hydrochloride (PubChem CID 119971647) has the molecular formula C10H13Cl2N3O4S and a molecular weight of 342.20 g/mol. Its IUPAC name is 1-(2-chloro-4-nitrophenyl)sulfonylpyrrolidin-3-amine;hydrochloride.
| Compound Name | 1-(2-chloro-4-nitrophenyl)sulfonylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119971647 |
| Molecular Formula | C10H13Cl2N3O4S |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 1-(2-chloro-4-nitrophenyl)sulfonylpyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.NC1CCN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2Cl)C1 |
| InChI | InChI=1S/C10H12ClN3O4S.ClH/c11-9-5-8(14(15)16)1-2-10(9)19(17,18)13-4-3-7(12)6-13;/h1-2,5,7H,3-4,6,12H2;1H |
| InChIKey | XSVAEAOWHHSIHC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|