C15H20ClN3O4S — CID 120714276
1-(2-chloro-4-nitrophenyl)sulfonyl-4-pyrrolidin-2-ylpiperidine (PubChem CID 120714276) has the molecular formula C15H20ClN3O4S and a molecular weight of 373.86 g/mol. Its IUPAC name is 1-(2-chloro-4-nitrophenyl)sulfonyl-4-pyrrolidin-2-ylpiperidine.
| Compound Name | 1-(2-chloro-4-nitrophenyl)sulfonyl-4-pyrrolidin-2-ylpiperidine |
|---|---|
| PubChem CID | 120714276 |
| Molecular Formula | C15H20ClN3O4S |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 1-(2-chloro-4-nitrophenyl)sulfonyl-4-pyrrolidin-2-ylpiperidine |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N2CCC(C3CCCN3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C15H20ClN3O4S/c16-13-10-12(19(20)21)3-4-15(13)24(22,23)18-8-5-11(6-9-18)14-2-1-7-17-14/h3-4,10-11,14,17H,1-2,5-9H2 |
| InChIKey | KOXGOSCRBVOCGG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|