C11H15Cl2N3O4S — CID 119963349
1-(2-chloro-4-nitrophenyl)sulfonyl-1,4-diazepane;hydrochloride (PubChem CID 119963349) has the molecular formula C11H15Cl2N3O4S and a molecular weight of 356.23 g/mol. Its IUPAC name is 1-(2-chloro-4-nitrophenyl)sulfonyl-1,4-diazepane;hydrochloride.
| Compound Name | 1-(2-chloro-4-nitrophenyl)sulfonyl-1,4-diazepane;hydrochloride |
|---|---|
| PubChem CID | 119963349 |
| Molecular Formula | C11H15Cl2N3O4S |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 1-(2-chloro-4-nitrophenyl)sulfonyl-1,4-diazepane;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(S(=O)(=O)N2CCCNCC2)c(Cl)c1 |
| InChI | InChI=1S/C11H14ClN3O4S.ClH/c12-10-8-9(15(16)17)2-3-11(10)20(18,19)14-6-1-4-13-5-7-14;/h2-3,8,13H,1,4-7H2;1H |
| InChIKey | VRRMDABOTQYRIG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|