C11H15Cl3N2O2S — CID 119963200
1-(2,3-dichlorophenyl)sulfonyl-1,4-diazepane;hydrochloride (PubChem CID 119963200) has the molecular formula C11H15Cl3N2O2S and a molecular weight of 345.68 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)sulfonyl-1,4-diazepane;hydrochloride.
| Compound Name | 1-(2,3-dichlorophenyl)sulfonyl-1,4-diazepane;hydrochloride |
|---|---|
| PubChem CID | 119963200 |
| Molecular Formula | C11H15Cl3N2O2S |
| Molecular Weight | 345.68 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 1-(2,3-dichlorophenyl)sulfonyl-1,4-diazepane;hydrochloride |
| SMILES | Cl.O=S(=O)(c1cccc(Cl)c1Cl)N1CCCNCC1 |
| InChI | InChI=1S/C11H14Cl2N2O2S.ClH/c12-9-3-1-4-10(11(9)13)18(16,17)15-7-2-5-14-6-8-15;/h1,3-4,14H,2,5-8H2;1H |
| InChIKey | VKZMXQKLEBJBFV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.68 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |