C14H18Cl2N2O2S — CID 56747043
7-(2,3-dichlorophenyl)sulfonyl-2,7-diazaspiro[4.5]decane (PubChem CID 56747043) has the molecular formula C14H18Cl2N2O2S and a molecular weight of 349.28 g/mol. Its IUPAC name is 7-(2,3-dichlorophenyl)sulfonyl-2,7-diazaspiro[4.5]decane.
| Compound Name | 7-(2,3-dichlorophenyl)sulfonyl-2,7-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 56747043 |
| Molecular Formula | C14H18Cl2N2O2S |
| Molecular Weight | 349.28 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 7-(2,3-dichlorophenyl)sulfonyl-2,7-diazaspiro[4.5]decane |
| SMILES | O=S(=O)(c1cccc(Cl)c1Cl)N1CCCC2(CCNC2)C1 |
| InChI | InChI=1S/C14H18Cl2N2O2S/c15-11-3-1-4-12(13(11)16)21(19,20)18-8-2-5-14(10-18)6-7-17-9-14/h1,3-4,17H,2,5-10H2 |
| InChIKey | OQHGOKJTONEYTR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |