C11H16N2O2S2 — CID 82038199
2-thiophen-2-ylsulfonyl-2,7-diazaspiro[4.4]nonane (PubChem CID 82038199) has the molecular formula C11H16N2O2S2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-thiophen-2-ylsulfonyl-2,7-diazaspiro[4.4]nonane.
| Compound Name | 2-thiophen-2-ylsulfonyl-2,7-diazaspiro[4.4]nonane |
|---|---|
| PubChem CID | 82038199 |
| Molecular Formula | C11H16N2O2S2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-thiophen-2-ylsulfonyl-2,7-diazaspiro[4.4]nonane |
| SMILES | O=S(=O)(c1cccs1)N1CCC2(CCNC2)C1 |
| InChI | InChI=1S/C11H16N2O2S2/c14-17(15,10-2-1-7-16-10)13-6-4-11(9-13)3-5-12-8-11/h1-2,7,12H,3-6,8-9H2 |
| InChIKey | XGZGZTYKXFSCEV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |