C13H20N2S — CID 82038614
2-(2-thiophen-2-ylethyl)-2,7-diazaspiro[4.4]nonane (PubChem CID 82038614) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is 2-(2-thiophen-2-ylethyl)-2,7-diazaspiro[4.4]nonane.
| Compound Name | 2-(2-thiophen-2-ylethyl)-2,7-diazaspiro[4.4]nonane |
|---|---|
| PubChem CID | 82038614 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-(2-thiophen-2-ylethyl)-2,7-diazaspiro[4.4]nonane |
| SMILES | c1csc(CCN2CCC3(CCNC3)C2)c1 |
| InChI | InChI=1S/C13H20N2S/c1-2-12(16-9-1)3-7-15-8-5-13(11-15)4-6-14-10-13/h1-2,9,14H,3-8,10-11H2 |
| InChIKey | FBKGKNRSFXXFJM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |