C16H17NO4S2 — CID 2564272
4-phenyl-1-thiophen-2-ylsulfonylpiperidine-4-carboxylic acid (PubChem CID 2564272) has the molecular formula C16H17NO4S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-phenyl-1-thiophen-2-ylsulfonylpiperidine-4-carboxylic acid.
| Compound Name | 4-phenyl-1-thiophen-2-ylsulfonylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 2564272 |
| Molecular Formula | C16H17NO4S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 4-phenyl-1-thiophen-2-ylsulfonylpiperidine-4-carboxylic acid |
| SMILES | O=C(O)C1(c2ccccc2)CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C16H17NO4S2/c18-15(19)16(13-5-2-1-3-6-13)8-10-17(11-9-16)23(20,21)14-7-4-12-22-14/h1-7,12H,8-11H2,(H,18,19) |
| InChIKey | USLPKEZSWWUSPC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |