About 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-phenylpiperidine-4-carboxylic acid
1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-phenylpiperidine-4-carboxylic acid (PubChem CID 45472651) has the molecular formula C20H17F6NO4S
and a molecular weight of 481.41 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-phenylpiperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-phenylpiperidine-4-carboxylic acid |
| PubChem CID | 45472651 |
| Molecular Formula | C20H17F6NO4S |
| Molecular Weight | 481.41 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-phenylpiperidine-4-carboxylic acid |
| SMILES | O=C(O)C1(c2ccccc2)CCN(S(=O)(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H17F6NO4S/c21-19(22,23)14-10-15(20(24,25)26)12-16(11-14)32(30,31)27-8-6-18(7-9-27,17(28)29)13-4-2-1-3-5-13/h1-5,10-12H,6-9H2,(H,28,29) |
| InChIKey | QZKDGOXYTALFLK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-phenylpiperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-phenylpiperidine-4-carboxylic acid?
The IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-phenylpiperidine-4-carboxylic acid (CID 45472651) is 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-phenylpiperidine-4-carboxylic acid.
What is the SMILES notation for 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-phenylpiperidine-4-carboxylic acid?
The canonical SMILES for 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-phenylpiperidine-4-carboxylic acid is O=C(O)C1(c2ccccc2)CCN(S(=O)(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1.
What is the InChIKey of 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-phenylpiperidine-4-carboxylic acid?
The InChIKey is QZKDGOXYTALFLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F6NO4S/c21-19(22,23)14-10-15(20(24,25)26)12-16(11-14)32(30,31)27-8-6-18(7-9-27,17(28)29)13-4-2-1-3-5-13/h1-5,10-12H,6-9H2,(H,28,29).
What are the key properties of 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-phenylpiperidine-4-carboxylic acid?
1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-phenylpiperidine-4-carboxylic acid has a molecular weight of 481.41 g/mol, XLogP of 4.53, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-phenylpiperidine-4-carboxylic acid is sourced from PubChem (CID 45472651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).