C18H17ClF3NO3S — CID 3282411
1-(3-chlorophenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol (PubChem CID 3282411) has the molecular formula C18H17ClF3NO3S and a molecular weight of 419.85 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol.
| Compound Name | 1-(3-chlorophenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 3282411 |
| Molecular Formula | C18H17ClF3NO3S |
| Molecular Weight | 419.85 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 1-(3-chlorophenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol |
| SMILES | O=S(=O)(c1cccc(Cl)c1)N1CCC(O)(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H17ClF3NO3S/c19-15-5-2-6-16(12-15)27(25,26)23-9-7-17(24,8-10-23)13-3-1-4-14(11-13)18(20,21)22/h1-6,11-12,24H,7-10H2 |
| InChIKey | CQIMWVZCJZYWGG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.85 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |