C20H19ClF3NO3S — CID 20511834
1-(4-methylphenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]piperidine-4-carbonyl chloride (PubChem CID 20511834) has the molecular formula C20H19ClF3NO3S and a molecular weight of 445.89 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]piperidine-4-carbonyl chloride.
| Compound Name | 1-(4-methylphenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]piperidine-4-carbonyl chloride |
|---|---|
| PubChem CID | 20511834 |
| Molecular Formula | C20H19ClF3NO3S |
| Molecular Weight | 445.89 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]piperidine-4-carbonyl chloride |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)Cl)(c3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C20H19ClF3NO3S/c1-14-5-7-17(8-6-14)29(27,28)25-11-9-19(10-12-25,18(21)26)15-3-2-4-16(13-15)20(22,23)24/h2-8,13H,9-12H2,1H3 |
| InChIKey | YEXVKPVHKVOTBS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.89 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|