C15H15F3NO4- — CID 152780099
4-methoxycarbonyl-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate (PubChem CID 152780099) has the molecular formula C15H15F3NO4- and a molecular weight of 330.28 g/mol. Its IUPAC name is 4-methoxycarbonyl-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate.
| Compound Name | 4-methoxycarbonyl-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 152780099 |
| Molecular Formula | C15H15F3NO4- |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 4-methoxycarbonyl-4-[3-(trifluoromethyl)phenyl]piperidine-1-carboxylate |
| SMILES | COC(=O)C1(c2cccc(C(F)(F)F)c2)CCN(C(=O)[O-])CC1 |
| InChI | InChI=1S/C15H16F3NO4/c1-23-12(20)14(5-7-19(8-6-14)13(21)22)10-3-2-4-11(9-10)15(16,17)18/h2-4,9H,5-8H2,1H3,(H,21,22)/p-1 |
| InChIKey | GVCPRBFVQOAAPJ-UHFFFAOYSA-M |
| XLogP | 1.56 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |