C14H16F3NO3S — CID 146154637
N-methylsulfonyl-1-[3-(trifluoromethyl)phenyl]cyclopentane-1-carboxamide (PubChem CID 146154637) has the molecular formula C14H16F3NO3S and a molecular weight of 335.35 g/mol. Its IUPAC name is N-methylsulfonyl-1-[3-(trifluoromethyl)phenyl]cyclopentane-1-carboxamide.
| Compound Name | N-methylsulfonyl-1-[3-(trifluoromethyl)phenyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 146154637 |
| Molecular Formula | C14H16F3NO3S |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | N-methylsulfonyl-1-[3-(trifluoromethyl)phenyl]cyclopentane-1-carboxamide |
| SMILES | CS(=O)(=O)NC(=O)C1(c2cccc(C(F)(F)F)c2)CCCC1 |
| InChI | InChI=1S/C14H16F3NO3S/c1-22(20,21)18-12(19)13(7-2-3-8-13)10-5-4-6-11(9-10)14(15,16)17/h4-6,9H,2-3,7-8H2,1H3,(H,18,19) |
| InChIKey | RXGUKXPBFYGAGC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |