C16H18F3NO3 — CID 119177258
3-[[1-[3-(trifluoromethyl)phenyl]cyclopentanecarbonyl]amino]propanoic acid (PubChem CID 119177258) has the molecular formula C16H18F3NO3 and a molecular weight of 329.32 g/mol. Its IUPAC name is 3-[[1-[3-(trifluoromethyl)phenyl]cyclopentanecarbonyl]amino]propanoic acid.
| Compound Name | 3-[[1-[3-(trifluoromethyl)phenyl]cyclopentanecarbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119177258 |
| Molecular Formula | C16H18F3NO3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 3-[[1-[3-(trifluoromethyl)phenyl]cyclopentanecarbonyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)C1(c2cccc(C(F)(F)F)c2)CCCC1 |
| InChI | InChI=1S/C16H18F3NO3/c17-16(18,19)12-5-3-4-11(10-12)15(7-1-2-8-15)14(23)20-9-6-13(21)22/h3-5,10H,1-2,6-9H2,(H,20,23)(H,21,22) |
| InChIKey | GOZSMRGBTQLMMU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |