C19H20ClF3N2O — CID 119549712
N-[2-(4-aminophenyl)ethyl]-1-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide;hydrochloride (PubChem CID 119549712) has the molecular formula C19H20ClF3N2O and a molecular weight of 384.83 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-1-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide;hydrochloride.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-1-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119549712 |
| Molecular Formula | C19H20ClF3N2O |
| Molecular Weight | 384.83 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-1-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide;hydrochloride |
| SMILES | Cl.Nc1ccc(CCNC(=O)C2(c3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C19H19F3N2O.ClH/c20-19(21,22)15-3-1-2-14(12-15)18(9-10-18)17(25)24-11-8-13-4-6-16(23)7-5-13;/h1-7,12H,8-11,23H2,(H,24,25);1H |
| InChIKey | XHECYRDMTOZJFN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.83 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|