C19H19F3N2O — CID 119806400
2-(4-aminophenyl)-N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]acetamide (PubChem CID 119806400) has the molecular formula C19H19F3N2O and a molecular weight of 348.37 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]acetamide.
| Compound Name | 2-(4-aminophenyl)-N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]acetamide |
|---|---|
| PubChem CID | 119806400 |
| Molecular Formula | C19H19F3N2O |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-(4-aminophenyl)-N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]acetamide |
| SMILES | Nc1ccc(CC(=O)NC2(c3cccc(C(F)(F)F)c3)CCC2)cc1 |
| InChI | InChI=1S/C19H19F3N2O/c20-19(21,22)15-4-1-3-14(12-15)18(9-2-10-18)24-17(25)11-13-5-7-16(23)8-6-13/h1,3-8,12H,2,9-11,23H2,(H,24,25) |
| InChIKey | LUIGDXXDNOGAJN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|