C19H19F3N2O — CID 120636519
5-amino-2-methyl-N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]benzamide (PubChem CID 120636519) has the molecular formula C19H19F3N2O and a molecular weight of 348.37 g/mol. Its IUPAC name is 5-amino-2-methyl-N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]benzamide.
| Compound Name | 5-amino-2-methyl-N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]benzamide |
|---|---|
| PubChem CID | 120636519 |
| Molecular Formula | C19H19F3N2O |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 5-amino-2-methyl-N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]benzamide |
| SMILES | Cc1ccc(N)cc1C(=O)NC1(c2cccc(C(F)(F)F)c2)CCC1 |
| InChI | InChI=1S/C19H19F3N2O/c1-12-6-7-15(23)11-16(12)17(25)24-18(8-3-9-18)13-4-2-5-14(10-13)19(20,21)22/h2,4-7,10-11H,3,8-9,23H2,1H3,(H,24,25) |
| InChIKey | KVCYZLVDHFESSQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|