C18H19F3N2O3 — CID 120625917
5-amino-N-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]-2-methylbenzamide (PubChem CID 120625917) has the molecular formula C18H19F3N2O3 and a molecular weight of 368.36 g/mol. Its IUPAC name is 5-amino-N-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]-2-methylbenzamide.
| Compound Name | 5-amino-N-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 120625917 |
| Molecular Formula | C18H19F3N2O3 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 5-amino-N-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]-2-methylbenzamide |
| SMILES | Cc1ccc(N)cc1C(=O)NCC(O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H19F3N2O3/c1-11-5-6-13(22)8-16(11)17(25)23-9-14(24)10-26-15-4-2-3-12(7-15)18(19,20)21/h2-8,14,24H,9-10,22H2,1H3,(H,23,25) |
| InChIKey | ZIQMIPPRWHMWMV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|