C16H16F3NO4 — CID 47932718
N-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]-2-methylfuran-3-carboxamide (PubChem CID 47932718) has the molecular formula C16H16F3NO4 and a molecular weight of 343.30 g/mol. Its IUPAC name is N-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]-2-methylfuran-3-carboxamide.
| Compound Name | N-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 47932718 |
| Molecular Formula | C16H16F3NO4 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]-2-methylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)NCC(O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H16F3NO4/c1-10-14(5-6-23-10)15(22)20-8-12(21)9-24-13-4-2-3-11(7-13)16(17,18)19/h2-7,12,21H,8-9H2,1H3,(H,20,22) |
| InChIKey | OCYDSPWZVHIUOQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |