C15H14F3NO4 — CID 47932845
N-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]furan-2-carboxamide (PubChem CID 47932845) has the molecular formula C15H14F3NO4 and a molecular weight of 329.27 g/mol. Its IUPAC name is N-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]furan-2-carboxamide.
| Compound Name | N-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 47932845 |
| Molecular Formula | C15H14F3NO4 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | N-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]furan-2-carboxamide |
| SMILES | O=C(NCC(O)COc1cccc(C(F)(F)F)c1)c1ccco1 |
| InChI | InChI=1S/C15H14F3NO4/c16-15(17,18)10-3-1-4-12(7-10)23-9-11(20)8-19-14(21)13-5-2-6-22-13/h1-7,11,20H,8-9H2,(H,19,21) |
| InChIKey | MDKNRDVQSBXNGX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |