C17H17F3N2O4 — CID 51120496
N-[1-oxo-1-[2-[3-(trifluoromethyl)phenoxy]ethylamino]propan-2-yl]furan-2-carboxamide (PubChem CID 51120496) has the molecular formula C17H17F3N2O4 and a molecular weight of 370.33 g/mol. Its IUPAC name is N-[1-oxo-1-[2-[3-(trifluoromethyl)phenoxy]ethylamino]propan-2-yl]furan-2-carboxamide.
| Compound Name | N-[1-oxo-1-[2-[3-(trifluoromethyl)phenoxy]ethylamino]propan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 51120496 |
| Molecular Formula | C17H17F3N2O4 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-[1-oxo-1-[2-[3-(trifluoromethyl)phenoxy]ethylamino]propan-2-yl]furan-2-carboxamide |
| SMILES | CC(NC(=O)c1ccco1)C(=O)NCCOc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H17F3N2O4/c1-11(22-16(24)14-6-3-8-26-14)15(23)21-7-9-25-13-5-2-4-12(10-13)17(18,19)20/h2-6,8,10-11H,7,9H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | XUZLFNVRQQEZJD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|