C17H19F3N2O2 — CID 75373653
1-N'-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]cyclopropane-1,1-dicarboxamide (PubChem CID 75373653) has the molecular formula C17H19F3N2O2 and a molecular weight of 340.34 g/mol. Its IUPAC name is 1-N'-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 75373653 |
| Molecular Formula | C17H19F3N2O2 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1-N'-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]cyclopropane-1,1-dicarboxamide |
| SMILES | NC(=O)C1(C(=O)NCC2(c3cccc(C(F)(F)F)c3)CCC2)CC1 |
| InChI | InChI=1S/C17H19F3N2O2/c18-17(19,20)12-4-1-3-11(9-12)15(5-2-6-15)10-22-14(24)16(7-8-16)13(21)23/h1,3-4,9H,2,5-8,10H2,(H2,21,23)(H,22,24) |
| InChIKey | GXFYRIADYKCVFM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|