C16H22ClF3N2O — CID 119335841
2-amino-N-[[1-[3-(trifluoromethyl)phenyl]cyclohexyl]methyl]acetamide;hydrochloride (PubChem CID 119335841) has the molecular formula C16H22ClF3N2O and a molecular weight of 350.81 g/mol. Its IUPAC name is 2-amino-N-[[1-[3-(trifluoromethyl)phenyl]cyclohexyl]methyl]acetamide;hydrochloride.
| Compound Name | 2-amino-N-[[1-[3-(trifluoromethyl)phenyl]cyclohexyl]methyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119335841 |
| Molecular Formula | C16H22ClF3N2O |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-amino-N-[[1-[3-(trifluoromethyl)phenyl]cyclohexyl]methyl]acetamide;hydrochloride |
| SMILES | Cl.NCC(=O)NCC1(c2cccc(C(F)(F)F)c2)CCCCC1 |
| InChI | InChI=1S/C16H21F3N2O.ClH/c17-16(18,19)13-6-4-5-12(9-13)15(7-2-1-3-8-15)11-21-14(22)10-20;/h4-6,9H,1-3,7-8,10-11,20H2,(H,21,22);1H |
| InChIKey | QQDLIIHIPYXCCV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |