C17H21F3N2O3 — CID 122003816
4-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methylcarbamoylamino]butanoic acid (PubChem CID 122003816) has the molecular formula C17H21F3N2O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is 4-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methylcarbamoylamino]butanoic acid.
| Compound Name | 4-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122003816 |
| Molecular Formula | C17H21F3N2O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 4-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methylcarbamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)NCC1(c2cccc(C(F)(F)F)c2)CCC1 |
| InChI | InChI=1S/C17H21F3N2O3/c18-17(19,20)13-5-1-4-12(10-13)16(7-3-8-16)11-22-15(25)21-9-2-6-14(23)24/h1,4-5,10H,2-3,6-9,11H2,(H,23,24)(H2,21,22,25) |
| InChIKey | FHRLGSWBLFQARY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|