C13H13F3O2 — CID 66748836
2-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]acetic acid (PubChem CID 66748836) has the molecular formula C13H13F3O2 and a molecular weight of 258.24 g/mol. Its IUPAC name is 2-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 66748836 |
| Molecular Formula | C13H13F3O2 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 2-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]acetic acid |
| SMILES | O=C(O)CC1(c2cccc(C(F)(F)F)c2)CCC1 |
| InChI | InChI=1S/C13H13F3O2/c14-13(15,16)10-4-1-3-9(7-10)12(5-2-6-12)8-11(17)18/h1,3-4,7H,2,5-6,8H2,(H,17,18) |
| InChIKey | OHRLLAYLTYKHEH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |