C17H18F3NO3 — CID 146099987
methyl (E)-5-[[1-[3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]pent-2-enoate (PubChem CID 146099987) has the molecular formula C17H18F3NO3 and a molecular weight of 341.33 g/mol. Its IUPAC name is methyl (E)-5-[[1-[3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]pent-2-enoate.
| Compound Name | methyl (E)-5-[[1-[3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]pent-2-enoate |
|---|---|
| PubChem CID | 146099987 |
| Molecular Formula | C17H18F3NO3 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | methyl (E)-5-[[1-[3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]pent-2-enoate |
| SMILES | COC(=O)/C=C/CCNC(=O)C1(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H18F3NO3/c1-24-14(22)7-2-3-10-21-15(23)16(8-9-16)12-5-4-6-13(11-12)17(18,19)20/h2,4-7,11H,3,8-10H2,1H3,(H,21,23)/b7-2+ |
| InChIKey | FMJDMQSXIKEERL-FARCUNLSSA-N |
| XLogP | 2.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|