C18H22F3NO2 — CID 111459667
N-[(3-hydroxycyclohexyl)methyl]-1-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 111459667) has the molecular formula C18H22F3NO2 and a molecular weight of 341.37 g/mol. Its IUPAC name is N-[(3-hydroxycyclohexyl)methyl]-1-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | N-[(3-hydroxycyclohexyl)methyl]-1-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 111459667 |
| Molecular Formula | C18H22F3NO2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | N-[(3-hydroxycyclohexyl)methyl]-1-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | O=C(NCC1CCCC(O)C1)C1(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H22F3NO2/c19-18(20,21)14-5-2-4-13(10-14)17(7-8-17)16(24)22-11-12-3-1-6-15(23)9-12/h2,4-5,10,12,15,23H,1,3,6-9,11H2,(H,22,24) |
| InChIKey | GIQHVNAINDMYIZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |