C19H29NO2 — CID 109379723
N-[(3-hydroxycyclohexyl)methyl]-4-methyl-4-phenylpentanamide (PubChem CID 109379723) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is N-[(3-hydroxycyclohexyl)methyl]-4-methyl-4-phenylpentanamide.
| Compound Name | N-[(3-hydroxycyclohexyl)methyl]-4-methyl-4-phenylpentanamide |
|---|---|
| PubChem CID | 109379723 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | N-[(3-hydroxycyclohexyl)methyl]-4-methyl-4-phenylpentanamide |
| SMILES | CC(C)(CCC(=O)NCC1CCCC(O)C1)c1ccccc1 |
| InChI | InChI=1S/C19H29NO2/c1-19(2,16-8-4-3-5-9-16)12-11-18(22)20-14-15-7-6-10-17(21)13-15/h3-5,8-9,15,17,21H,6-7,10-14H2,1-2H3,(H,20,22) |
| InChIKey | YYCFRINIEXGQKG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |