C12H21NO3 — CID 106135913
N-[(3-hydroxycyclohexyl)methyl]-4-oxopentanamide (PubChem CID 106135913) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is N-[(3-hydroxycyclohexyl)methyl]-4-oxopentanamide.
| Compound Name | N-[(3-hydroxycyclohexyl)methyl]-4-oxopentanamide |
|---|---|
| PubChem CID | 106135913 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | N-[(3-hydroxycyclohexyl)methyl]-4-oxopentanamide |
| SMILES | CC(=O)CCC(=O)NCC1CCCC(O)C1 |
| InChI | InChI=1S/C12H21NO3/c1-9(14)5-6-12(16)13-8-10-3-2-4-11(15)7-10/h10-11,15H,2-8H2,1H3,(H,13,16) |
| InChIKey | UIULZQRSIVSDCR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |