C12H23NO2S — CID 111460060
3-ethylsulfanyl-N-[(3-hydroxycyclohexyl)methyl]propanamide (PubChem CID 111460060) has the molecular formula C12H23NO2S and a molecular weight of 245.39 g/mol. Its IUPAC name is 3-ethylsulfanyl-N-[(3-hydroxycyclohexyl)methyl]propanamide.
| Compound Name | 3-ethylsulfanyl-N-[(3-hydroxycyclohexyl)methyl]propanamide |
|---|---|
| PubChem CID | 111460060 |
| Molecular Formula | C12H23NO2S |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 3-ethylsulfanyl-N-[(3-hydroxycyclohexyl)methyl]propanamide |
| SMILES | CCSCCC(=O)NCC1CCCC(O)C1 |
| InChI | InChI=1S/C12H23NO2S/c1-2-16-7-6-12(15)13-9-10-4-3-5-11(14)8-10/h10-11,14H,2-9H2,1H3,(H,13,15) |
| InChIKey | RGWGEZIAZMDQPR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|