C16H22F3NO — CID 103785891
3-[[1-[3-(trifluoromethyl)phenyl]ethylamino]methyl]cyclohexan-1-ol (PubChem CID 103785891) has the molecular formula C16H22F3NO and a molecular weight of 301.35 g/mol. Its IUPAC name is 3-[[1-[3-(trifluoromethyl)phenyl]ethylamino]methyl]cyclohexan-1-ol.
| Compound Name | 3-[[1-[3-(trifluoromethyl)phenyl]ethylamino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 103785891 |
| Molecular Formula | C16H22F3NO |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 3-[[1-[3-(trifluoromethyl)phenyl]ethylamino]methyl]cyclohexan-1-ol |
| SMILES | CC(NCC1CCCC(O)C1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H22F3NO/c1-11(20-10-12-4-2-7-15(21)8-12)13-5-3-6-14(9-13)16(17,18)19/h3,5-6,9,11-12,15,20-21H,2,4,7-8,10H2,1H3 |
| InChIKey | ZBWIROIVZREAFY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |