C16H22F3NO2S — CID 95733802
1-cyclohexyl-N-[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]methanesulfonamide (PubChem CID 95733802) has the molecular formula C16H22F3NO2S and a molecular weight of 349.42 g/mol. Its IUPAC name is 1-cyclohexyl-N-[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]methanesulfonamide.
| Compound Name | 1-cyclohexyl-N-[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 95733802 |
| Molecular Formula | C16H22F3NO2S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 1-cyclohexyl-N-[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]methanesulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)CC1CCCCC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H22F3NO2S/c1-12(14-8-5-9-15(10-14)16(17,18)19)20-23(21,22)11-13-6-3-2-4-7-13/h5,8-10,12-13,20H,2-4,6-7,11H2,1H3/t12-/m1/s1 |
| InChIKey | HHSPNPDKQQZKQX-GFCCVEGCSA-N |
| XLogP | 4.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |