C14H18F3NS — CID 80584198
N-(thiolan-2-ylmethyl)-1-[3-(trifluoromethyl)phenyl]ethanamine (PubChem CID 80584198) has the molecular formula C14H18F3NS and a molecular weight of 289.37 g/mol. Its IUPAC name is N-(thiolan-2-ylmethyl)-1-[3-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | N-(thiolan-2-ylmethyl)-1-[3-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 80584198 |
| Molecular Formula | C14H18F3NS |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-(thiolan-2-ylmethyl)-1-[3-(trifluoromethyl)phenyl]ethanamine |
| SMILES | CC(NCC1CCCS1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H18F3NS/c1-10(18-9-13-6-3-7-19-13)11-4-2-5-12(8-11)14(15,16)17/h2,4-5,8,10,13,18H,3,6-7,9H2,1H3 |
| InChIKey | QSNJHDIJLUESKX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |