C15H20F3NS — CID 80601126
N-(thian-2-ylmethyl)-1-[2-(trifluoromethyl)phenyl]ethanamine (PubChem CID 80601126) has the molecular formula C15H20F3NS and a molecular weight of 303.39 g/mol. Its IUPAC name is N-(thian-2-ylmethyl)-1-[2-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | N-(thian-2-ylmethyl)-1-[2-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 80601126 |
| Molecular Formula | C15H20F3NS |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-(thian-2-ylmethyl)-1-[2-(trifluoromethyl)phenyl]ethanamine |
| SMILES | CC(NCC1CCCCS1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H20F3NS/c1-11(19-10-12-6-4-5-9-20-12)13-7-2-3-8-14(13)15(16,17)18/h2-3,7-8,11-12,19H,4-6,9-10H2,1H3 |
| InChIKey | DZBLDEVWWVXENC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |