C19H23NS — CID 80594842
1,1-diphenyl-N-(thian-2-ylmethyl)methanamine (PubChem CID 80594842) has the molecular formula C19H23NS and a molecular weight of 297.47 g/mol. Its IUPAC name is 1,1-diphenyl-N-(thian-2-ylmethyl)methanamine.
| Compound Name | 1,1-diphenyl-N-(thian-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 80594842 |
| Molecular Formula | C19H23NS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 1,1-diphenyl-N-(thian-2-ylmethyl)methanamine |
| SMILES | c1ccc(C(NCC2CCCCS2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H23NS/c1-3-9-16(10-4-1)19(17-11-5-2-6-12-17)20-15-18-13-7-8-14-21-18/h1-6,9-12,18-20H,7-8,13-15H2 |
| InChIKey | WSIYIMDQCOVEEL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |