C16H25NS — CID 80600271
1-(2,5-dimethylphenyl)-N-(thian-2-ylmethyl)ethanamine (PubChem CID 80600271) has the molecular formula C16H25NS and a molecular weight of 263.45 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-N-(thian-2-ylmethyl)ethanamine.
| Compound Name | 1-(2,5-dimethylphenyl)-N-(thian-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 80600271 |
| Molecular Formula | C16H25NS |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-N-(thian-2-ylmethyl)ethanamine |
| SMILES | Cc1ccc(C)c(C(C)NCC2CCCCS2)c1 |
| InChI | InChI=1S/C16H25NS/c1-12-7-8-13(2)16(10-12)14(3)17-11-15-6-4-5-9-18-15/h7-8,10,14-15,17H,4-6,9,11H2,1-3H3 |
| InChIKey | ZBOAILGPUBHPGV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |