C15H23NS — CID 107131699
1-(2,5-dimethylphenyl)-N-(thiolan-3-ylmethyl)ethanamine (PubChem CID 107131699) has the molecular formula C15H23NS and a molecular weight of 249.42 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-N-(thiolan-3-ylmethyl)ethanamine.
| Compound Name | 1-(2,5-dimethylphenyl)-N-(thiolan-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 107131699 |
| Molecular Formula | C15H23NS |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-N-(thiolan-3-ylmethyl)ethanamine |
| SMILES | Cc1ccc(C)c(C(C)NCC2CCSC2)c1 |
| InChI | InChI=1S/C15H23NS/c1-11-4-5-12(2)15(8-11)13(3)16-9-14-6-7-17-10-14/h4-5,8,13-14,16H,6-7,9-10H2,1-3H3 |
| InChIKey | RLNVLBCPAXPSQW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |