C13H19NS — CID 107131111
2,4-dimethyl-N-(thiolan-3-ylmethyl)aniline (PubChem CID 107131111) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is 2,4-dimethyl-N-(thiolan-3-ylmethyl)aniline.
| Compound Name | 2,4-dimethyl-N-(thiolan-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 107131111 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2,4-dimethyl-N-(thiolan-3-ylmethyl)aniline |
| SMILES | Cc1ccc(NCC2CCSC2)c(C)c1 |
| InChI | InChI=1S/C13H19NS/c1-10-3-4-13(11(2)7-10)14-8-12-5-6-15-9-12/h3-4,7,12,14H,5-6,8-9H2,1-2H3 |
| InChIKey | VKGFLASPWJQBSL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |