C18H18F3NO2 — CID 51123307
N-(furan-3-ylmethyl)-1-[3-(trifluoromethyl)phenyl]cyclopentane-1-carboxamide (PubChem CID 51123307) has the molecular formula C18H18F3NO2 and a molecular weight of 337.34 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-1-[3-(trifluoromethyl)phenyl]cyclopentane-1-carboxamide.
| Compound Name | N-(furan-3-ylmethyl)-1-[3-(trifluoromethyl)phenyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 51123307 |
| Molecular Formula | C18H18F3NO2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N-(furan-3-ylmethyl)-1-[3-(trifluoromethyl)phenyl]cyclopentane-1-carboxamide |
| SMILES | O=C(NCc1ccoc1)C1(c2cccc(C(F)(F)F)c2)CCCC1 |
| InChI | InChI=1S/C18H18F3NO2/c19-18(20,21)15-5-3-4-14(10-15)17(7-1-2-8-17)16(23)22-11-13-6-9-24-12-13/h3-6,9-10,12H,1-2,7-8,11H2,(H,22,23) |
| InChIKey | NSJBHHVIDQXVHW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |