C21H21F4NO — CID 18449573
1-(2-fluorophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]cyclohexane-1-carboxamide (PubChem CID 18449573) has the molecular formula C21H21F4NO and a molecular weight of 379.40 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]cyclohexane-1-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 18449573 |
| Molecular Formula | C21H21F4NO |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 1-(2-fluorophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]cyclohexane-1-carboxamide |
| SMILES | O=C(NCc1cccc(C(F)(F)F)c1)C1(c2ccccc2F)CCCCC1 |
| InChI | InChI=1S/C21H21F4NO/c22-18-10-3-2-9-17(18)20(11-4-1-5-12-20)19(27)26-14-15-7-6-8-16(13-15)21(23,24)25/h2-3,6-10,13H,1,4-5,11-12,14H2,(H,26,27) |
| InChIKey | KLJFQFBJQDTTIS-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |