C17H13F4NO — CID 26241538
(E)-3-(2-fluorophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]prop-2-enamide (PubChem CID 26241538) has the molecular formula C17H13F4NO and a molecular weight of 323.29 g/mol. Its IUPAC name is (E)-3-(2-fluorophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(2-fluorophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 26241538 |
| Molecular Formula | C17H13F4NO |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | (E)-3-(2-fluorophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1F)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H13F4NO/c18-15-7-2-1-5-13(15)8-9-16(23)22-11-12-4-3-6-14(10-12)17(19,20)21/h1-10H,11H2,(H,22,23)/b9-8+ |
| InChIKey | JITMCJODFWWHGG-CMDGGOBGSA-N |
| XLogP | 4.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|