C19H17F3N2O3 — CID 122514292
2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-N-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 122514292) has the molecular formula C19H17F3N2O3 and a molecular weight of 378.35 g/mol. Its IUPAC name is 2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-N-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-N-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 122514292 |
| Molecular Formula | C19H17F3N2O3 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-N-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | CN(Cc1cccc(C(F)(F)F)c1)C(=O)c1ccccc1/C=C/C(=O)NO |
| InChI | InChI=1S/C19H17F3N2O3/c1-24(12-13-5-4-7-15(11-13)19(20,21)22)18(26)16-8-3-2-6-14(16)9-10-17(25)23-27/h2-11,27H,12H2,1H3,(H,23,25)/b10-9+ |
| InChIKey | YVRDPKVHSUAIFT-MDZDMXLPSA-N |
| XLogP | 3.50 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|