C17H14F5NO2 — CID 136577410
3-(difluoromethoxy)-N-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 136577410) has the molecular formula C17H14F5NO2 and a molecular weight of 359.29 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 3-(difluoromethoxy)-N-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 136577410 |
| Molecular Formula | C17H14F5NO2 |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 3-(difluoromethoxy)-N-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | CN(Cc1cccc(C(F)(F)F)c1)C(=O)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C17H14F5NO2/c1-23(10-11-4-2-6-13(8-11)17(20,21)22)15(24)12-5-3-7-14(9-12)25-16(18)19/h2-9,16H,10H2,1H3 |
| InChIKey | IEKGJFGYNFMUCY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |