C18H14F5NO4 — CID 42970121
[3-(trifluoromethyl)phenyl]methyl 2-[[3-(difluoromethoxy)benzoyl]amino]acetate (PubChem CID 42970121) has the molecular formula C18H14F5NO4 and a molecular weight of 403.30 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl]methyl 2-[[3-(difluoromethoxy)benzoyl]amino]acetate.
| Compound Name | [3-(trifluoromethyl)phenyl]methyl 2-[[3-(difluoromethoxy)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 42970121 |
| Molecular Formula | C18H14F5NO4 |
| Molecular Weight | 403.30 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]methyl 2-[[3-(difluoromethoxy)benzoyl]amino]acetate |
| SMILES | O=C(CNC(=O)c1cccc(OC(F)F)c1)OCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H14F5NO4/c19-17(20)28-14-6-2-4-12(8-14)16(26)24-9-15(25)27-10-11-3-1-5-13(7-11)18(21,22)23/h1-8,17H,9-10H2,(H,24,26) |
| InChIKey | JEXKVTRSUYUHGR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.30 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |