C18H15F6NO2S — CID 2742040
3-(trifluoromethoxy)-N-[2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]ethyl]benzamide (PubChem CID 2742040) has the molecular formula C18H15F6NO2S and a molecular weight of 423.38 g/mol. Its IUPAC name is 3-(trifluoromethoxy)-N-[2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]ethyl]benzamide.
| Compound Name | 3-(trifluoromethoxy)-N-[2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 2742040 |
| Molecular Formula | C18H15F6NO2S |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | 3-(trifluoromethoxy)-N-[2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]ethyl]benzamide |
| SMILES | O=C(NCCSCc1cccc(C(F)(F)F)c1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C18H15F6NO2S/c19-17(20,21)14-5-1-3-12(9-14)11-28-8-7-25-16(26)13-4-2-6-15(10-13)27-18(22,23)24/h1-6,9-10H,7-8,11H2,(H,25,26) |
| InChIKey | DKJHCOGJDIBAML-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|