C18H18F3NO2S — CID 2742043
4-methoxy-N-[2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]ethyl]benzamide (PubChem CID 2742043) has the molecular formula C18H18F3NO2S and a molecular weight of 369.41 g/mol. Its IUPAC name is 4-methoxy-N-[2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]ethyl]benzamide.
| Compound Name | 4-methoxy-N-[2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 2742043 |
| Molecular Formula | C18H18F3NO2S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 4-methoxy-N-[2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCSCc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H18F3NO2S/c1-24-16-7-5-14(6-8-16)17(23)22-9-10-25-12-13-3-2-4-15(11-13)18(19,20)21/h2-8,11H,9-10,12H2,1H3,(H,22,23) |
| InChIKey | AMUJCTZCDNOTDA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|