C18H14F3N3O3 — CID 51123670
N-methyl-2,3-dioxo-N-[[3-(trifluoromethyl)phenyl]methyl]-1,4-dihydroquinoxaline-6-carboxamide (PubChem CID 51123670) has the molecular formula C18H14F3N3O3 and a molecular weight of 377.32 g/mol. Its IUPAC name is N-methyl-2,3-dioxo-N-[[3-(trifluoromethyl)phenyl]methyl]-1,4-dihydroquinoxaline-6-carboxamide.
| Compound Name | N-methyl-2,3-dioxo-N-[[3-(trifluoromethyl)phenyl]methyl]-1,4-dihydroquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 51123670 |
| Molecular Formula | C18H14F3N3O3 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-methyl-2,3-dioxo-N-[[3-(trifluoromethyl)phenyl]methyl]-1,4-dihydroquinoxaline-6-carboxamide |
| SMILES | CN(Cc1cccc(C(F)(F)F)c1)C(=O)c1ccc2[nH]c(=O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C18H14F3N3O3/c1-24(9-10-3-2-4-12(7-10)18(19,20)21)17(27)11-5-6-13-14(8-11)23-16(26)15(25)22-13/h2-8H,9H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | POHNQFDMIIRHIB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|