C16H13Cl2F2NO2 — CID 112792497
N-[(3,4-dichlorophenyl)methyl]-3-(difluoromethoxy)-N-methylbenzamide (PubChem CID 112792497) has the molecular formula C16H13Cl2F2NO2 and a molecular weight of 360.19 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-3-(difluoromethoxy)-N-methylbenzamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-3-(difluoromethoxy)-N-methylbenzamide |
|---|---|
| PubChem CID | 112792497 |
| Molecular Formula | C16H13Cl2F2NO2 |
| Molecular Weight | 360.19 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-3-(difluoromethoxy)-N-methylbenzamide |
| SMILES | CN(Cc1ccc(Cl)c(Cl)c1)C(=O)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C16H13Cl2F2NO2/c1-21(9-10-5-6-13(17)14(18)7-10)15(22)11-3-2-4-12(8-11)23-16(19)20/h2-8,16H,9H2,1H3 |
| InChIKey | NLDHPYMPBBDWDY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.19 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |